C18H21N3O2 — CID 9070716
4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl]-2H-phthalazin-1-one (PubChem CID 9070716) has the molecular formula C18H21N3O2 and a molecular weight of 311.38 g/mol. Its IUPAC name is 4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl]-2H-phthalazin-1-one.
| Compound Name | 4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 9070716 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl]-2H-phthalazin-1-one |
| SMILES | O=C(c1n[nH]c(=O)c2ccccc12)N1CC[C@H]2CCCC[C@H]2C1 |
| InChI | InChI=1S/C18H21N3O2/c22-17-15-8-4-3-7-14(15)16(19-20-17)18(23)21-10-9-12-5-1-2-6-13(12)11-21/h3-4,7-8,12-13H,1-2,5-6,9-11H2,(H,20,22)/t12-,13+/m1/s1 |
| InChIKey | FSSYEDURCBCUQY-OLZOCXBDSA-N |
| XLogP | 2.58 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |