About 4-[(3S,4S)-3-hydroxy-4-phenylpiperidine-1-carbonyl]-2H-phthalazin-1-one
4-[(3S,4S)-3-hydroxy-4-phenylpiperidine-1-carbonyl]-2H-phthalazin-1-one (PubChem CID 16674823) has the molecular formula C20H19N3O3
and a molecular weight of 349.39 g/mol. Its IUPAC name is 4-[(3S,4S)-3-hydroxy-4-phenylpiperidine-1-carbonyl]-2H-phthalazin-1-one.
Molecular Properties
| Compound Name | 4-[(3S,4S)-3-hydroxy-4-phenylpiperidine-1-carbonyl]-2H-phthalazin-1-one |
| PubChem CID | 16674823 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 4-[(3S,4S)-3-hydroxy-4-phenylpiperidine-1-carbonyl]-2H-phthalazin-1-one |
| SMILES | O=C(c1n[nH]c(=O)c2ccccc12)N1CC[C@@H](c2ccccc2)[C@H](O)C1 |
| InChI | InChI=1S/C20H19N3O3/c24-17-12-23(11-10-14(17)13-6-2-1-3-7-13)20(26)18-15-8-4-5-9-16(15)19(25)22-21-18/h1-9,14,17,24H,10-12H2,(H,22,25)/t14-,17+/m0/s1 |
| InChIKey | LEEFFJAZINSMRY-WMLDXEAASA-N |
| XLogP | 1.91 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(3S,4S)-3-hydroxy-4-phenylpiperidine-1-carbonyl]-2H-phthalazin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3S,4S)-3-hydroxy-4-phenylpiperidine-1-carbonyl]-2H-phthalazin-1-one?
The IUPAC name of 4-[(3S,4S)-3-hydroxy-4-phenylpiperidine-1-carbonyl]-2H-phthalazin-1-one (CID 16674823) is 4-[(3S,4S)-3-hydroxy-4-phenylpiperidine-1-carbonyl]-2H-phthalazin-1-one.
What is the SMILES notation for 4-[(3S,4S)-3-hydroxy-4-phenylpiperidine-1-carbonyl]-2H-phthalazin-1-one?
The canonical SMILES for 4-[(3S,4S)-3-hydroxy-4-phenylpiperidine-1-carbonyl]-2H-phthalazin-1-one is O=C(c1n[nH]c(=O)c2ccccc12)N1CC[C@@H](c2ccccc2)[C@H](O)C1.
What is the InChIKey of 4-[(3S,4S)-3-hydroxy-4-phenylpiperidine-1-carbonyl]-2H-phthalazin-1-one?
The InChIKey is LEEFFJAZINSMRY-WMLDXEAASA-N. The full InChI is InChI=1S/C20H19N3O3/c24-17-12-23(11-10-14(17)13-6-2-1-3-7-13)20(26)18-15-8-4-5-9-16(15)19(25)22-21-18/h1-9,14,17,24H,10-12H2,(H,22,25)/t14-,17+/m0/s1.
What are the key properties of 4-[(3S,4S)-3-hydroxy-4-phenylpiperidine-1-carbonyl]-2H-phthalazin-1-one?
4-[(3S,4S)-3-hydroxy-4-phenylpiperidine-1-carbonyl]-2H-phthalazin-1-one has a molecular weight of 349.39 g/mol, XLogP of 1.91, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3S,4S)-3-hydroxy-4-phenylpiperidine-1-carbonyl]-2H-phthalazin-1-one is sourced from PubChem (CID 16674823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).