C15H16N4O3 — CID 95871248
6-[(2R)-2-pyridin-2-ylpiperidine-1-carbonyl]-1H-pyrimidine-2,4-dione (PubChem CID 95871248) has the molecular formula C15H16N4O3 and a molecular weight of 300.32 g/mol. Its IUPAC name is 6-[(2R)-2-pyridin-2-ylpiperidine-1-carbonyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-[(2R)-2-pyridin-2-ylpiperidine-1-carbonyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 95871248 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 6-[(2R)-2-pyridin-2-ylpiperidine-1-carbonyl]-1H-pyrimidine-2,4-dione |
| SMILES | O=C(c1cc(=O)[nH]c(=O)[nH]1)N1CCCC[C@@H]1c1ccccn1 |
| InChI | InChI=1S/C15H16N4O3/c20-13-9-11(17-15(22)18-13)14(21)19-8-4-2-6-12(19)10-5-1-3-7-16-10/h1,3,5,7,9,12H,2,4,6,8H2,(H2,17,18,20,22)/t12-/m1/s1 |
| InChIKey | LJUNETIAZCVLGN-GFCCVEGCSA-N |
| XLogP | 0.83 |
| TPSA | 98.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |