C17H19N3O4 — CID 70774580
6-[2-(3-methoxyphenyl)piperidine-1-carbonyl]-1H-pyrimidine-2,4-dione (PubChem CID 70774580) has the molecular formula C17H19N3O4 and a molecular weight of 329.36 g/mol. Its IUPAC name is 6-[2-(3-methoxyphenyl)piperidine-1-carbonyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-[2-(3-methoxyphenyl)piperidine-1-carbonyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70774580 |
| Molecular Formula | C17H19N3O4 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 6-[2-(3-methoxyphenyl)piperidine-1-carbonyl]-1H-pyrimidine-2,4-dione |
| SMILES | COc1cccc(C2CCCCN2C(=O)c2cc(=O)[nH]c(=O)[nH]2)c1 |
| InChI | InChI=1S/C17H19N3O4/c1-24-12-6-4-5-11(9-12)14-7-2-3-8-20(14)16(22)13-10-15(21)19-17(23)18-13/h4-6,9-10,14H,2-3,7-8H2,1H3,(H2,18,19,21,23) |
| InChIKey | HMOCMDVHHXNCFM-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 95.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |