C8H14O3 — CID 13412067
(4S,5R)-5-hydroxy-4,6,6-trimethyloxan-2-one (PubChem CID 13412067) has the molecular formula C8H14O3 and a molecular weight of 158.20 g/mol. Its IUPAC name is (4S,5R)-5-hydroxy-4,6,6-trimethyloxan-2-one.
| Compound Name | (4S,5R)-5-hydroxy-4,6,6-trimethyloxan-2-one |
|---|---|
| PubChem CID | 13412067 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | (4S,5R)-5-hydroxy-4,6,6-trimethyloxan-2-one |
| SMILES | C[C@H]1CC(=O)OC(C)(C)[C@@H]1O |
| InChI | InChI=1S/C8H14O3/c1-5-4-6(9)11-8(2,3)7(5)10/h5,7,10H,4H2,1-3H3/t5-,7+/m0/s1 |
| InChIKey | ADKWLQYGBDUFQN-CAHLUQPWSA-N |
| XLogP | 0.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |