C8H14O3 — CID 101461458
(5R)-5-methoxy-6,6-dimethyloxan-2-one (PubChem CID 101461458) has the molecular formula C8H14O3 and a molecular weight of 158.20 g/mol. Its IUPAC name is (5R)-5-methoxy-6,6-dimethyloxan-2-one.
| Compound Name | (5R)-5-methoxy-6,6-dimethyloxan-2-one |
|---|---|
| PubChem CID | 101461458 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | (5R)-5-methoxy-6,6-dimethyloxan-2-one |
| SMILES | CO[C@@H]1CCC(=O)OC1(C)C |
| InChI | InChI=1S/C8H14O3/c1-8(2)6(10-3)4-5-7(9)11-8/h6H,4-5H2,1-3H3/t6-/m1/s1 |
| InChIKey | XJAPUPLRUZDFRW-ZCFIWIBFSA-N |
| XLogP | 1.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |