C17H28O3 — CID 162786821
(1R,2S,5R,8S)-2-ethoxy-4,4,8-trimethyl-9-oxatricyclo[6.4.1.01,5]tridecan-10-one (PubChem CID 162786821) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is (1R,2S,5R,8S)-2-ethoxy-4,4,8-trimethyl-9-oxatricyclo[6.4.1.01,5]tridecan-10-one.
| Compound Name | (1R,2S,5R,8S)-2-ethoxy-4,4,8-trimethyl-9-oxatricyclo[6.4.1.01,5]tridecan-10-one |
|---|---|
| PubChem CID | 162786821 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | (1R,2S,5R,8S)-2-ethoxy-4,4,8-trimethyl-9-oxatricyclo[6.4.1.01,5]tridecan-10-one |
| SMILES | CCO[C@H]1CC(C)(C)[C@H]2CC[C@@]3(C)C[C@@]12CCC(=O)O3 |
| InChI | InChI=1S/C17H28O3/c1-5-19-13-10-15(2,3)12-6-8-16(4)11-17(12,13)9-7-14(18)20-16/h12-13H,5-11H2,1-4H3/t12-,13+,16+,17-/m1/s1 |
| InChIKey | UBOUZJZBMVCAFV-OSRSDYAFSA-N |
| XLogP | 3.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |