C13H18O2 — CID 23631696
(1aR,4aS,8aR)-5,5-dimethyl-1a,3,4,4a,7,8-hexahydro-1H-cyclopropa[j]naphthalene-2,6-dione (PubChem CID 23631696) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is (1aR,4aS,8aR)-5,5-dimethyl-1a,3,4,4a,7,8-hexahydro-1H-cyclopropa[j]naphthalene-2,6-dione.
| Compound Name | (1aR,4aS,8aR)-5,5-dimethyl-1a,3,4,4a,7,8-hexahydro-1H-cyclopropa[j]naphthalene-2,6-dione |
|---|---|
| PubChem CID | 23631696 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | (1aR,4aS,8aR)-5,5-dimethyl-1a,3,4,4a,7,8-hexahydro-1H-cyclopropa[j]naphthalene-2,6-dione |
| SMILES | CC1(C)C(=O)CC[C@]23C[C@H]2C(=O)CC[C@H]13 |
| InChI | InChI=1S/C13H18O2/c1-12(2)10-4-3-9(14)8-7-13(8,10)6-5-11(12)15/h8,10H,3-7H2,1-2H3/t8-,10+,13-/m0/s1 |
| InChIKey | IGQPRZNUPQSHSB-PLMOITTCSA-N |
| XLogP | 2.36 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |