C15H32O — CID 144627113
ethane;2,2,3,4,4-pentamethylcyclohexan-1-one (PubChem CID 144627113) has the molecular formula C15H32O and a molecular weight of 228.42 g/mol. Its IUPAC name is ethane;2,2,3,4,4-pentamethylcyclohexan-1-one.
| Compound Name | ethane;2,2,3,4,4-pentamethylcyclohexan-1-one |
|---|---|
| PubChem CID | 144627113 |
| Molecular Formula | C15H32O |
| Molecular Weight | 228.42 g/mol |
| Exact Mass | 228.25 |
| IUPAC Name | ethane;2,2,3,4,4-pentamethylcyclohexan-1-one |
| SMILES | CC.CC.CC1C(C)(C)CCC(=O)C1(C)C |
| InChI | InChI=1S/C11H20O.2C2H6/c1-8-10(2,3)7-6-9(12)11(8,4)5;2*1-2/h8H,6-7H2,1-5H3;2*1-2H3 |
| InChIKey | NHJWEDCXNFIQCS-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.42 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |