C8H11BrO2 — CID 154728965
3-bromo-2,2-dimethylcyclohexane-1,4-dione (PubChem CID 154728965) has the molecular formula C8H11BrO2 and a molecular weight of 219.08 g/mol. Its IUPAC name is 3-bromo-2,2-dimethylcyclohexane-1,4-dione.
| Compound Name | 3-bromo-2,2-dimethylcyclohexane-1,4-dione |
|---|---|
| PubChem CID | 154728965 |
| Molecular Formula | C8H11BrO2 |
| Molecular Weight | 219.08 g/mol |
| Exact Mass | 217.99 |
| IUPAC Name | 3-bromo-2,2-dimethylcyclohexane-1,4-dione |
| SMILES | CC1(C)C(=O)CCC(=O)C1Br |
| InChI | InChI=1S/C8H11BrO2/c1-8(2)6(11)4-3-5(10)7(8)9/h7H,3-4H2,1-2H3 |
| InChIKey | QTDMFSMOROFEDO-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.08 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|