C14H20O2 — CID 15385781
(1aR,3aS,7aS,7bR)-1,1,3a-trimethyl-2,3,5,6,7a,7b-hexahydro-1aH-cyclopropa[a]naphthalene-4,7-dione (PubChem CID 15385781) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is (1aR,3aS,7aS,7bR)-1,1,3a-trimethyl-2,3,5,6,7a,7b-hexahydro-1aH-cyclopropa[a]naphthalene-4,7-dione.
| Compound Name | (1aR,3aS,7aS,7bR)-1,1,3a-trimethyl-2,3,5,6,7a,7b-hexahydro-1aH-cyclopropa[a]naphthalene-4,7-dione |
|---|---|
| PubChem CID | 15385781 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | (1aR,3aS,7aS,7bR)-1,1,3a-trimethyl-2,3,5,6,7a,7b-hexahydro-1aH-cyclopropa[a]naphthalene-4,7-dione |
| SMILES | CC1(C)[C@@H]2[C@H]1CC[C@]1(C)C(=O)CCC(=O)[C@@H]21 |
| InChI | InChI=1S/C14H20O2/c1-13(2)8-6-7-14(3)10(16)5-4-9(15)12(14)11(8)13/h8,11-12H,4-7H2,1-3H3/t8-,11-,12+,14-/m1/s1 |
| InChIKey | FKOKHQSDRFQWNI-PKINLEFWSA-N |
| XLogP | 2.61 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |