C7H9ClO — CID 124748765
(1S,5S,6S)-6-chloro-6-methylbicyclo[3.1.0]hexan-2-one (PubChem CID 124748765) has the molecular formula C7H9ClO and a molecular weight of 144.60 g/mol. Its IUPAC name is (1S,5S,6S)-6-chloro-6-methylbicyclo[3.1.0]hexan-2-one.
| Compound Name | (1S,5S,6S)-6-chloro-6-methylbicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 124748765 |
| Molecular Formula | C7H9ClO |
| Molecular Weight | 144.60 g/mol |
| Exact Mass | 144.03 |
| IUPAC Name | (1S,5S,6S)-6-chloro-6-methylbicyclo[3.1.0]hexan-2-one |
| SMILES | C[C@@]1(Cl)[C@@H]2C(=O)CC[C@@H]21 |
| InChI | InChI=1S/C7H9ClO/c1-7(8)4-2-3-5(9)6(4)7/h4,6H,2-3H2,1H3/t4-,6-,7-/m0/s1 |
| InChIKey | ZNVASLZCGNQJDR-QTSITTDLSA-N |
| XLogP | 1.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.60 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|