C8H9ClO3 — CID 101134105
methyl (1S,5S,6S)-6-chloro-2-oxobicyclo[3.1.0]hexane-6-carboxylate (PubChem CID 101134105) has the molecular formula C8H9ClO3 and a molecular weight of 188.61 g/mol. Its IUPAC name is methyl (1S,5S,6S)-6-chloro-2-oxobicyclo[3.1.0]hexane-6-carboxylate.
| Compound Name | methyl (1S,5S,6S)-6-chloro-2-oxobicyclo[3.1.0]hexane-6-carboxylate |
|---|---|
| PubChem CID | 101134105 |
| Molecular Formula | C8H9ClO3 |
| Molecular Weight | 188.61 g/mol |
| Exact Mass | 188.02 |
| IUPAC Name | methyl (1S,5S,6S)-6-chloro-2-oxobicyclo[3.1.0]hexane-6-carboxylate |
| SMILES | COC(=O)[C@@]1(Cl)[C@@H]2C(=O)CC[C@@H]21 |
| InChI | InChI=1S/C8H9ClO3/c1-12-7(11)8(9)4-2-3-5(10)6(4)8/h4,6H,2-3H2,1H3/t4-,6-,8-/m0/s1 |
| InChIKey | FJNNGUAROFIPEB-WSDOSGOUSA-N |
| XLogP | 0.75 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.61 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|