C24H24O10 — CID 14292525
tetramethyl (1S,2R,8S,9R,15R,16R)-7,14-dioxopentacyclo[7.5.1.12,5.012,15.08,16]hexadeca-5,12-diene-1,6,8,13-tetracarboxylate (PubChem CID 14292525) has the molecular formula C24H24O10 and a molecular weight of 472.45 g/mol. Its IUPAC name is tetramethyl (1S,2R,8S,9R,15R,16R)-7,14-dioxopentacyclo[7.5.1.12,5.012,15.08,16]hexadeca-5,12-diene-1,6,8,13-tetracarboxylate.
| Compound Name | tetramethyl (1S,2R,8S,9R,15R,16R)-7,14-dioxopentacyclo[7.5.1.12,5.012,15.08,16]hexadeca-5,12-diene-1,6,8,13-tetracarboxylate |
|---|---|
| PubChem CID | 14292525 |
| Molecular Formula | C24H24O10 |
| Molecular Weight | 472.45 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | tetramethyl (1S,2R,8S,9R,15R,16R)-7,14-dioxopentacyclo[7.5.1.12,5.012,15.08,16]hexadeca-5,12-diene-1,6,8,13-tetracarboxylate |
| SMILES | COC(=O)C1=C2CC[C@@H]3[C@H]2[C@](C(=O)OC)(C1=O)[C@@H]1CCC2=C(C(=O)OC)C(=O)[C@@]3(C(=O)OC)[C@@H]21 |
| InChI | InChI=1S/C24H24O10/c1-31-19(27)13-9-5-7-11-15(9)23(17(13)25,21(29)33-3)12-8-6-10-14(20(28)32-2)18(26)24(11,16(10)12)22(30)34-4/h11-12,15-16H,5-8H2,1-4H3/t11-,12-,15+,16+,23+,24+/m1/s1 |
| InChIKey | OVTCVGDXODBSGV-SLWWZUEGSA-N |
| XLogP | 0.48 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.45 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|