C19H26O4 — CID 102018554
dimethyl 2,3,4,4a,6a,7,8,9,10,11-decahydro-1H-cyclohepta[c]naphthalene-5,6-dicarboxylate (PubChem CID 102018554) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is dimethyl 2,3,4,4a,6a,7,8,9,10,11-decahydro-1H-cyclohepta[c]naphthalene-5,6-dicarboxylate.
| Compound Name | dimethyl 2,3,4,4a,6a,7,8,9,10,11-decahydro-1H-cyclohepta[c]naphthalene-5,6-dicarboxylate |
|---|---|
| PubChem CID | 102018554 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | dimethyl 2,3,4,4a,6a,7,8,9,10,11-decahydro-1H-cyclohepta[c]naphthalene-5,6-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2CCCCC2=C2CCCCCC21 |
| InChI | InChI=1S/C19H26O4/c1-22-18(20)16-14-10-5-3-4-8-12(14)13-9-6-7-11-15(13)17(16)19(21)23-2/h14-15H,3-11H2,1-2H3 |
| InChIKey | ZTCJPBAGDRDCIV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|