C19H18O4 — CID 139092044
methyl (12aR)-6-oxo-7,9,10,11,12,12a-hexahydronaphtho[2,1-c]chromene-8-carboxylate (PubChem CID 139092044) has the molecular formula C19H18O4 and a molecular weight of 310.35 g/mol. Its IUPAC name is methyl (12aR)-6-oxo-7,9,10,11,12,12a-hexahydronaphtho[2,1-c]chromene-8-carboxylate.
| Compound Name | methyl (12aR)-6-oxo-7,9,10,11,12,12a-hexahydronaphtho[2,1-c]chromene-8-carboxylate |
|---|---|
| PubChem CID | 139092044 |
| Molecular Formula | C19H18O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | methyl (12aR)-6-oxo-7,9,10,11,12,12a-hexahydronaphtho[2,1-c]chromene-8-carboxylate |
| SMILES | COC(=O)C1=C2CCCC[C@H]2c2c(c(=O)oc3ccccc23)C1 |
| InChI | InChI=1S/C19H18O4/c1-22-18(20)14-10-15-17(12-7-3-2-6-11(12)14)13-8-4-5-9-16(13)23-19(15)21/h4-5,8-9,12H,2-3,6-7,10H2,1H3/t12-/m1/s1 |
| InChIKey | XZKORLQFOFNWIM-GFCCVEGCSA-N |
| XLogP | 3.48 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|