C14H11NO4 — CID 46873555
methyl 2-methyl-4-oxo-3H-chromeno[3,4-b]pyrrole-1-carboxylate (PubChem CID 46873555) has the molecular formula C14H11NO4 and a molecular weight of 257.24 g/mol. Its IUPAC name is methyl 2-methyl-4-oxo-3H-chromeno[3,4-b]pyrrole-1-carboxylate.
| Compound Name | methyl 2-methyl-4-oxo-3H-chromeno[3,4-b]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 46873555 |
| Molecular Formula | C14H11NO4 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | methyl 2-methyl-4-oxo-3H-chromeno[3,4-b]pyrrole-1-carboxylate |
| SMILES | COC(=O)c1c(C)[nH]c2c(=O)oc3ccccc3c12 |
| InChI | InChI=1S/C14H11NO4/c1-7-10(13(16)18-2)11-8-5-3-4-6-9(8)19-14(17)12(11)15-7/h3-6,15H,1-2H3 |
| InChIKey | FWGLOZKWRQBQPP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 72.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|