C18H11F3O7 — CID 54768421
dimethyl 9-hydroxy-6-oxo-7-(trifluoromethyl)benzo[c]chromene-8,10-dicarboxylate (PubChem CID 54768421) has the molecular formula C18H11F3O7 and a molecular weight of 396.27 g/mol. Its IUPAC name is dimethyl 9-hydroxy-6-oxo-7-(trifluoromethyl)benzo[c]chromene-8,10-dicarboxylate.
| Compound Name | dimethyl 9-hydroxy-6-oxo-7-(trifluoromethyl)benzo[c]chromene-8,10-dicarboxylate |
|---|---|
| PubChem CID | 54768421 |
| Molecular Formula | C18H11F3O7 |
| Molecular Weight | 396.27 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | dimethyl 9-hydroxy-6-oxo-7-(trifluoromethyl)benzo[c]chromene-8,10-dicarboxylate |
| SMILES | COC(=O)c1c(O)c(C(=O)OC)c2c(c1C(F)(F)F)c(=O)oc1ccccc12 |
| InChI | InChI=1S/C18H11F3O7/c1-26-15(23)11-9-7-5-3-4-6-8(7)28-17(25)10(9)13(18(19,20)21)12(14(11)22)16(24)27-2/h3-6,22H,1-2H3 |
| InChIKey | KDXOZOSNGUMYBR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.27 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|