About 2-aminodibenzofuran-1-carboxylic acid;methyl 2-aminodibenzofuran-1-carboxylate
2-aminodibenzofuran-1-carboxylic acid;methyl 2-aminodibenzofuran-1-carboxylate (PubChem CID 158161401) has the molecular formula C27H20N2O6
and a molecular weight of 468.47 g/mol. Its IUPAC name is 2-aminodibenzofuran-1-carboxylic acid;methyl 2-aminodibenzofuran-1-carboxylate.
Molecular Properties
| Compound Name | 2-aminodibenzofuran-1-carboxylic acid;methyl 2-aminodibenzofuran-1-carboxylate |
| PubChem CID | 158161401 |
| Molecular Formula | C27H20N2O6 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 2-aminodibenzofuran-1-carboxylic acid;methyl 2-aminodibenzofuran-1-carboxylate |
| SMILES | COC(=O)c1c(N)ccc2oc3ccccc3c12.Nc1ccc2oc3ccccc3c2c1C(=O)O |
| InChI | InChI=1S/C14H11NO3.C13H9NO3/c1-17-14(16)13-9(15)6-7-11-12(13)8-4-2-3-5-10(8)18-11;14-8-5-6-10-11(12(8)13(15)16)7-3-1-2-4-9(7)17-10/h2-7H,15H2,1H3;1-6H,14H2,(H,15,16) |
| InChIKey | FWHWJEOMQSSUSE-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 141.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-aminodibenzofuran-1-carboxylic acid;methyl 2-aminodibenzofuran-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminodibenzofuran-1-carboxylic acid;methyl 2-aminodibenzofuran-1-carboxylate?
The IUPAC name of 2-aminodibenzofuran-1-carboxylic acid;methyl 2-aminodibenzofuran-1-carboxylate (CID 158161401) is 2-aminodibenzofuran-1-carboxylic acid;methyl 2-aminodibenzofuran-1-carboxylate.
What is the SMILES notation for 2-aminodibenzofuran-1-carboxylic acid;methyl 2-aminodibenzofuran-1-carboxylate?
The canonical SMILES for 2-aminodibenzofuran-1-carboxylic acid;methyl 2-aminodibenzofuran-1-carboxylate is COC(=O)c1c(N)ccc2oc3ccccc3c12.Nc1ccc2oc3ccccc3c2c1C(=O)O.
What is the InChIKey of 2-aminodibenzofuran-1-carboxylic acid;methyl 2-aminodibenzofuran-1-carboxylate?
The InChIKey is FWHWJEOMQSSUSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO3.C13H9NO3/c1-17-14(16)13-9(15)6-7-11-12(13)8-4-2-3-5-10(8)18-11;14-8-5-6-10-11(12(8)13(15)16)7-3-1-2-4-9(7)17-10/h2-7H,15H2,1H3;1-6H,14H2,(H,15,16).
What are the key properties of 2-aminodibenzofuran-1-carboxylic acid;methyl 2-aminodibenzofuran-1-carboxylate?
2-aminodibenzofuran-1-carboxylic acid;methyl 2-aminodibenzofuran-1-carboxylate has a molecular weight of 468.47 g/mol, XLogP of 5.82, 2 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminodibenzofuran-1-carboxylic acid;methyl 2-aminodibenzofuran-1-carboxylate is sourced from PubChem (CID 158161401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).