C27H18O8 — CID 54682609
methyl 4-[bis(4-hydroxy-2-oxochromen-3-yl)methyl]benzoate (PubChem CID 54682609) has the molecular formula C27H18O8 and a molecular weight of 470.43 g/mol. Its IUPAC name is methyl 4-[bis(4-hydroxy-2-oxochromen-3-yl)methyl]benzoate.
| Compound Name | methyl 4-[bis(4-hydroxy-2-oxochromen-3-yl)methyl]benzoate |
|---|---|
| PubChem CID | 54682609 |
| Molecular Formula | C27H18O8 |
| Molecular Weight | 470.43 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | methyl 4-[bis(4-hydroxy-2-oxochromen-3-yl)methyl]benzoate |
| SMILES | COC(=O)c1ccc(C(c2c(O)c3ccccc3oc2=O)c2c(O)c3ccccc3oc2=O)cc1 |
| InChI | InChI=1S/C27H18O8/c1-33-25(30)15-12-10-14(11-13-15)20(21-23(28)16-6-2-4-8-18(16)34-26(21)31)22-24(29)17-7-3-5-9-19(17)35-27(22)32/h2-13,20,28-29H,1H3 |
| InChIKey | NOURXFNARQPXTM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 127.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|