C27H19FO7 — CID 134091551
3-[[4-(2-fluoroethoxy)phenyl]-(4-hydroxy-2-oxochromen-3-yl)methyl]-4-hydroxychromen-2-one (PubChem CID 134091551) has the molecular formula C27H19FO7 and a molecular weight of 474.44 g/mol. Its IUPAC name is 3-[[4-(2-fluoroethoxy)phenyl]-(4-hydroxy-2-oxochromen-3-yl)methyl]-4-hydroxychromen-2-one.
| Compound Name | 3-[[4-(2-fluoroethoxy)phenyl]-(4-hydroxy-2-oxochromen-3-yl)methyl]-4-hydroxychromen-2-one |
|---|---|
| PubChem CID | 134091551 |
| Molecular Formula | C27H19FO7 |
| Molecular Weight | 474.44 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | 3-[[4-(2-fluoroethoxy)phenyl]-(4-hydroxy-2-oxochromen-3-yl)methyl]-4-hydroxychromen-2-one |
| SMILES | O=c1oc2ccccc2c(O)c1C(c1ccc(OCCF)cc1)c1c(O)c2ccccc2oc1=O |
| InChI | InChI=1S/C27H19FO7/c28-13-14-33-16-11-9-15(10-12-16)21(22-24(29)17-5-1-3-7-19(17)34-26(22)31)23-25(30)18-6-2-4-8-20(18)35-27(23)32/h1-12,21,29-30H,13-14H2 |
| InChIKey | RHCPCEMQGJPMLM-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 110.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.44 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|