C28H22O7 — CID 139833895
4-hydroxy-3-[(4-hydroxy-2-oxochromen-3-yl)-(3-propoxyphenyl)methyl]chromen-2-one (PubChem CID 139833895) has the molecular formula C28H22O7 and a molecular weight of 470.48 g/mol. Its IUPAC name is 4-hydroxy-3-[(4-hydroxy-2-oxochromen-3-yl)-(3-propoxyphenyl)methyl]chromen-2-one.
| Compound Name | 4-hydroxy-3-[(4-hydroxy-2-oxochromen-3-yl)-(3-propoxyphenyl)methyl]chromen-2-one |
|---|---|
| PubChem CID | 139833895 |
| Molecular Formula | C28H22O7 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 4-hydroxy-3-[(4-hydroxy-2-oxochromen-3-yl)-(3-propoxyphenyl)methyl]chromen-2-one |
| SMILES | CCCOc1cccc(C(c2c(O)c3ccccc3oc2=O)c2c(O)c3ccccc3oc2=O)c1 |
| InChI | InChI=1S/C28H22O7/c1-2-14-33-17-9-7-8-16(15-17)22(23-25(29)18-10-3-5-12-20(18)34-27(23)31)24-26(30)19-11-4-6-13-21(19)35-28(24)32/h3-13,15,22,29-30H,2,14H2,1H3 |
| InChIKey | GUEDDKXVYKRFJS-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 110.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|