C26H17NO10 — CID 54679257
4-hydroxy-3-[(3-hydroxy-4-methoxy-5-nitrophenyl)-(4-hydroxy-2-oxochromen-3-yl)methyl]chromen-2-one (PubChem CID 54679257) has the molecular formula C26H17NO10 and a molecular weight of 503.42 g/mol. Its IUPAC name is 4-hydroxy-3-[(3-hydroxy-4-methoxy-5-nitrophenyl)-(4-hydroxy-2-oxochromen-3-yl)methyl]chromen-2-one.
| Compound Name | 4-hydroxy-3-[(3-hydroxy-4-methoxy-5-nitrophenyl)-(4-hydroxy-2-oxochromen-3-yl)methyl]chromen-2-one |
|---|---|
| PubChem CID | 54679257 |
| Molecular Formula | C26H17NO10 |
| Molecular Weight | 503.42 g/mol |
| Exact Mass | 503.09 |
| IUPAC Name | 4-hydroxy-3-[(3-hydroxy-4-methoxy-5-nitrophenyl)-(4-hydroxy-2-oxochromen-3-yl)methyl]chromen-2-one |
| SMILES | COc1c(O)cc(C(c2c(O)c3ccccc3oc2=O)c2c(O)c3ccccc3oc2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H17NO10/c1-35-24-15(27(33)34)10-12(11-16(24)28)19(20-22(29)13-6-2-4-8-17(13)36-25(20)31)21-23(30)14-7-3-5-9-18(14)37-26(21)32/h2-11,19,28-30H,1H3 |
| InChIKey | ATNZLSPMJKRZAW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 173.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|