C34H25NO10 — CID 54683674
4-hydroxy-3-[(4-hydroxy-2-oxochromen-3-yl)-[4-methoxy-3-[(3-methyl-4-nitrophenoxy)methyl]phenyl]methyl]chromen-2-one (PubChem CID 54683674) has the molecular formula C34H25NO10 and a molecular weight of 607.57 g/mol. Its IUPAC name is 4-hydroxy-3-[(4-hydroxy-2-oxochromen-3-yl)-[4-methoxy-3-[(3-methyl-4-nitrophenoxy)methyl]phenyl]methyl]chromen-2-one.
| Compound Name | 4-hydroxy-3-[(4-hydroxy-2-oxochromen-3-yl)-[4-methoxy-3-[(3-methyl-4-nitrophenoxy)methyl]phenyl]methyl]chromen-2-one |
|---|---|
| PubChem CID | 54683674 |
| Molecular Formula | C34H25NO10 |
| Molecular Weight | 607.57 g/mol |
| Exact Mass | 607.15 |
| IUPAC Name | 4-hydroxy-3-[(4-hydroxy-2-oxochromen-3-yl)-[4-methoxy-3-[(3-methyl-4-nitrophenoxy)methyl]phenyl]methyl]chromen-2-one |
| SMILES | COc1ccc(C(c2c(O)c3ccccc3oc2=O)c2c(O)c3ccccc3oc2=O)cc1COc1ccc([N+](=O)[O-])c(C)c1 |
| InChI | InChI=1S/C34H25NO10/c1-18-15-21(12-13-24(18)35(40)41)43-17-20-16-19(11-14-25(20)42-2)28(29-31(36)22-7-3-5-9-26(22)44-33(29)38)30-32(37)23-8-4-6-10-27(23)45-34(30)39/h3-16,28,36-37H,17H2,1-2H3 |
| InChIKey | JHPCWZRCVASGRX-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 162.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.57 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|