C19H16O6 — CID 54687528
3-(4-hydroxy-2-oxochromen-3-yl)-3-(4-methoxyphenyl)propanoic acid (PubChem CID 54687528) has the molecular formula C19H16O6 and a molecular weight of 340.33 g/mol. Its IUPAC name is 3-(4-hydroxy-2-oxochromen-3-yl)-3-(4-methoxyphenyl)propanoic acid.
| Compound Name | 3-(4-hydroxy-2-oxochromen-3-yl)-3-(4-methoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 54687528 |
| Molecular Formula | C19H16O6 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 3-(4-hydroxy-2-oxochromen-3-yl)-3-(4-methoxyphenyl)propanoic acid |
| SMILES | COc1ccc(C(CC(=O)O)c2c(O)c3ccccc3oc2=O)cc1 |
| InChI | InChI=1S/C19H16O6/c1-24-12-8-6-11(7-9-12)14(10-16(20)21)17-18(22)13-4-2-3-5-15(13)25-19(17)23/h2-9,14,22H,10H2,1H3,(H,20,21) |
| InChIKey | FAEAJGNFHUTMPK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|