C30H31NO8 — CID 124890876
(3R)-3-(4-hydroxy-2-oxochromen-3-yl)-N-[2-(4-methoxyphenyl)ethyl]-3-(3,4,5-trimethoxyphenyl)propanamide (PubChem CID 124890876) has the molecular formula C30H31NO8 and a molecular weight of 533.58 g/mol. Its IUPAC name is (3R)-3-(4-hydroxy-2-oxochromen-3-yl)-N-[2-(4-methoxyphenyl)ethyl]-3-(3,4,5-trimethoxyphenyl)propanamide.
| Compound Name | (3R)-3-(4-hydroxy-2-oxochromen-3-yl)-N-[2-(4-methoxyphenyl)ethyl]-3-(3,4,5-trimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 124890876 |
| Molecular Formula | C30H31NO8 |
| Molecular Weight | 533.58 g/mol |
| Exact Mass | 533.20 |
| IUPAC Name | (3R)-3-(4-hydroxy-2-oxochromen-3-yl)-N-[2-(4-methoxyphenyl)ethyl]-3-(3,4,5-trimethoxyphenyl)propanamide |
| SMILES | COc1ccc(CCNC(=O)C[C@H](c2cc(OC)c(OC)c(OC)c2)c2c(O)c3ccccc3oc2=O)cc1 |
| InChI | InChI=1S/C30H31NO8/c1-35-20-11-9-18(10-12-20)13-14-31-26(32)17-22(19-15-24(36-2)29(38-4)25(16-19)37-3)27-28(33)21-7-5-6-8-23(21)39-30(27)34/h5-12,15-16,22,33H,13-14,17H2,1-4H3,(H,31,32)/t22-/m1/s1 |
| InChIKey | WPVBNYKIOFDVCV-JOCHJYFZSA-N |
| XLogP | 4.41 |
| TPSA | 116.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.58 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|