C29H28FNO7 — CID 124891434
(3R)-N-[2-(4-fluorophenyl)ethyl]-3-(4-hydroxy-2-oxochromen-3-yl)-3-(3,4,5-trimethoxyphenyl)propanamide (PubChem CID 124891434) has the molecular formula C29H28FNO7 and a molecular weight of 521.54 g/mol. Its IUPAC name is (3R)-N-[2-(4-fluorophenyl)ethyl]-3-(4-hydroxy-2-oxochromen-3-yl)-3-(3,4,5-trimethoxyphenyl)propanamide.
| Compound Name | (3R)-N-[2-(4-fluorophenyl)ethyl]-3-(4-hydroxy-2-oxochromen-3-yl)-3-(3,4,5-trimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 124891434 |
| Molecular Formula | C29H28FNO7 |
| Molecular Weight | 521.54 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | (3R)-N-[2-(4-fluorophenyl)ethyl]-3-(4-hydroxy-2-oxochromen-3-yl)-3-(3,4,5-trimethoxyphenyl)propanamide |
| SMILES | COc1cc([C@@H](CC(=O)NCCc2ccc(F)cc2)c2c(O)c3ccccc3oc2=O)cc(OC)c1OC |
| InChI | InChI=1S/C29H28FNO7/c1-35-23-14-18(15-24(36-2)28(23)37-3)21(16-25(32)31-13-12-17-8-10-19(30)11-9-17)26-27(33)20-6-4-5-7-22(20)38-29(26)34/h4-11,14-15,21,33H,12-13,16H2,1-3H3,(H,31,32)/t21-/m1/s1 |
| InChIKey | RBICTJODMMLJMH-OAQYLSRUSA-N |
| XLogP | 4.54 |
| TPSA | 107.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.54 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|