C31H30N2O7 — CID 91973680
3-(4-hydroxy-2-oxochromen-3-yl)-N-[2-(1H-indol-3-yl)ethyl]-3-(3,4,5-trimethoxyphenyl)propanamide (PubChem CID 91973680) has the molecular formula C31H30N2O7 and a molecular weight of 542.59 g/mol. Its IUPAC name is 3-(4-hydroxy-2-oxochromen-3-yl)-N-[2-(1H-indol-3-yl)ethyl]-3-(3,4,5-trimethoxyphenyl)propanamide.
| Compound Name | 3-(4-hydroxy-2-oxochromen-3-yl)-N-[2-(1H-indol-3-yl)ethyl]-3-(3,4,5-trimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 91973680 |
| Molecular Formula | C31H30N2O7 |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.21 |
| IUPAC Name | 3-(4-hydroxy-2-oxochromen-3-yl)-N-[2-(1H-indol-3-yl)ethyl]-3-(3,4,5-trimethoxyphenyl)propanamide |
| SMILES | COc1cc(C(CC(=O)NCCc2c[nH]c3ccccc23)c2c(O)c3ccccc3oc2=O)cc(OC)c1OC |
| InChI | InChI=1S/C31H30N2O7/c1-37-25-14-19(15-26(38-2)30(25)39-3)22(28-29(35)21-9-5-7-11-24(21)40-31(28)36)16-27(34)32-13-12-18-17-33-23-10-6-4-8-20(18)23/h4-11,14-15,17,22,33,35H,12-13,16H2,1-3H3,(H,32,34) |
| InChIKey | IAHVEZJAHUEABK-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 123.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|