C27H24FNO6 — CID 124891519
(3S)-N-[2-(4-fluorophenyl)ethyl]-3-(3-hydroxy-4-methoxyphenyl)-3-(4-hydroxy-2-oxochromen-3-yl)propanamide (PubChem CID 124891519) has the molecular formula C27H24FNO6 and a molecular weight of 477.49 g/mol. Its IUPAC name is (3S)-N-[2-(4-fluorophenyl)ethyl]-3-(3-hydroxy-4-methoxyphenyl)-3-(4-hydroxy-2-oxochromen-3-yl)propanamide.
| Compound Name | (3S)-N-[2-(4-fluorophenyl)ethyl]-3-(3-hydroxy-4-methoxyphenyl)-3-(4-hydroxy-2-oxochromen-3-yl)propanamide |
|---|---|
| PubChem CID | 124891519 |
| Molecular Formula | C27H24FNO6 |
| Molecular Weight | 477.49 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | (3S)-N-[2-(4-fluorophenyl)ethyl]-3-(3-hydroxy-4-methoxyphenyl)-3-(4-hydroxy-2-oxochromen-3-yl)propanamide |
| SMILES | COc1ccc([C@H](CC(=O)NCCc2ccc(F)cc2)c2c(O)c3ccccc3oc2=O)cc1O |
| InChI | InChI=1S/C27H24FNO6/c1-34-23-11-8-17(14-21(23)30)20(15-24(31)29-13-12-16-6-9-18(28)10-7-16)25-26(32)19-4-2-3-5-22(19)35-27(25)33/h2-11,14,20,30,32H,12-13,15H2,1H3,(H,29,31)/t20-/m0/s1 |
| InChIKey | ULLOFLIJJWGVGD-FQEVSTJZSA-N |
| XLogP | 4.23 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.49 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|