C33H37NO9 — CID 124891299
(3R)-N-[2-(3,4-diethoxyphenyl)ethyl]-3-(4-hydroxy-2-oxochromen-3-yl)-3-(3,4,5-trimethoxyphenyl)propanamide (PubChem CID 124891299) has the molecular formula C33H37NO9 and a molecular weight of 591.66 g/mol. Its IUPAC name is (3R)-N-[2-(3,4-diethoxyphenyl)ethyl]-3-(4-hydroxy-2-oxochromen-3-yl)-3-(3,4,5-trimethoxyphenyl)propanamide.
| Compound Name | (3R)-N-[2-(3,4-diethoxyphenyl)ethyl]-3-(4-hydroxy-2-oxochromen-3-yl)-3-(3,4,5-trimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 124891299 |
| Molecular Formula | C33H37NO9 |
| Molecular Weight | 591.66 g/mol |
| Exact Mass | 591.25 |
| IUPAC Name | (3R)-N-[2-(3,4-diethoxyphenyl)ethyl]-3-(4-hydroxy-2-oxochromen-3-yl)-3-(3,4,5-trimethoxyphenyl)propanamide |
| SMILES | CCOc1ccc(CCNC(=O)C[C@H](c2cc(OC)c(OC)c(OC)c2)c2c(O)c3ccccc3oc2=O)cc1OCC |
| InChI | InChI=1S/C33H37NO9/c1-6-41-25-13-12-20(16-26(25)42-7-2)14-15-34-29(35)19-23(21-17-27(38-3)32(40-5)28(18-21)39-4)30-31(36)22-10-8-9-11-24(22)43-33(30)37/h8-13,16-18,23,36H,6-7,14-15,19H2,1-5H3,(H,34,35)/t23-/m1/s1 |
| InChIKey | OALFPNFMTQTJMR-HSZRJFAPSA-N |
| XLogP | 5.20 |
| TPSA | 125.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.66 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|