C29H27NO8 — CID 124891079
(3R)-3-(1,3-benzodioxol-5-yl)-N-[(3-ethoxy-4-methoxyphenyl)methyl]-3-(4-hydroxy-2-oxochromen-3-yl)propanamide (PubChem CID 124891079) has the molecular formula C29H27NO8 and a molecular weight of 517.53 g/mol. Its IUPAC name is (3R)-3-(1,3-benzodioxol-5-yl)-N-[(3-ethoxy-4-methoxyphenyl)methyl]-3-(4-hydroxy-2-oxochromen-3-yl)propanamide.
| Compound Name | (3R)-3-(1,3-benzodioxol-5-yl)-N-[(3-ethoxy-4-methoxyphenyl)methyl]-3-(4-hydroxy-2-oxochromen-3-yl)propanamide |
|---|---|
| PubChem CID | 124891079 |
| Molecular Formula | C29H27NO8 |
| Molecular Weight | 517.53 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | (3R)-3-(1,3-benzodioxol-5-yl)-N-[(3-ethoxy-4-methoxyphenyl)methyl]-3-(4-hydroxy-2-oxochromen-3-yl)propanamide |
| SMILES | CCOc1cc(CNC(=O)C[C@H](c2ccc3c(c2)OCO3)c2c(O)c3ccccc3oc2=O)ccc1OC |
| InChI | InChI=1S/C29H27NO8/c1-3-35-24-12-17(8-10-22(24)34-2)15-30-26(31)14-20(18-9-11-23-25(13-18)37-16-36-23)27-28(32)19-6-4-5-7-21(19)38-29(27)33/h4-13,20,32H,3,14-16H2,1-2H3,(H,30,31)/t20-/m1/s1 |
| InChIKey | IEDXXNDFIUTHII-HXUWFJFHSA-N |
| XLogP | 4.47 |
| TPSA | 116.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.53 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|