C20H16O7 — CID 99993083
methyl (3S)-3-(1,3-benzodioxol-5-yl)-3-(4-hydroxy-2-oxochromen-3-yl)propanoate (PubChem CID 99993083) has the molecular formula C20H16O7 and a molecular weight of 368.34 g/mol. Its IUPAC name is methyl (3S)-3-(1,3-benzodioxol-5-yl)-3-(4-hydroxy-2-oxochromen-3-yl)propanoate.
| Compound Name | methyl (3S)-3-(1,3-benzodioxol-5-yl)-3-(4-hydroxy-2-oxochromen-3-yl)propanoate |
|---|---|
| PubChem CID | 99993083 |
| Molecular Formula | C20H16O7 |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | methyl (3S)-3-(1,3-benzodioxol-5-yl)-3-(4-hydroxy-2-oxochromen-3-yl)propanoate |
| SMILES | COC(=O)C[C@@H](c1ccc2c(c1)OCO2)c1c(O)c2ccccc2oc1=O |
| InChI | InChI=1S/C20H16O7/c1-24-17(21)9-13(11-6-7-15-16(8-11)26-10-25-15)18-19(22)12-4-2-3-5-14(12)27-20(18)23/h2-8,13,22H,9-10H2,1H3/t13-/m0/s1 |
| InChIKey | VABSXQDQQNHUSJ-ZDUSSCGKSA-N |
| XLogP | 2.92 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|