C27H18O8 — CID 59746836
3-[2,3-dihydro-1,4-benzodioxin-6-yl-(4-hydroxy-2-oxochromen-3-yl)methyl]-4-hydroxychromen-2-one (PubChem CID 59746836) has the molecular formula C27H18O8 and a molecular weight of 470.43 g/mol. Its IUPAC name is 3-[2,3-dihydro-1,4-benzodioxin-6-yl-(4-hydroxy-2-oxochromen-3-yl)methyl]-4-hydroxychromen-2-one.
| Compound Name | 3-[2,3-dihydro-1,4-benzodioxin-6-yl-(4-hydroxy-2-oxochromen-3-yl)methyl]-4-hydroxychromen-2-one |
|---|---|
| PubChem CID | 59746836 |
| Molecular Formula | C27H18O8 |
| Molecular Weight | 470.43 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | 3-[2,3-dihydro-1,4-benzodioxin-6-yl-(4-hydroxy-2-oxochromen-3-yl)methyl]-4-hydroxychromen-2-one |
| SMILES | O=c1oc2ccccc2c(O)c1C(c1ccc2c(c1)OCCO2)c1c(O)c2ccccc2oc1=O |
| InChI | InChI=1S/C27H18O8/c28-24-15-5-1-3-7-17(15)34-26(30)22(24)21(14-9-10-19-20(13-14)33-12-11-32-19)23-25(29)16-6-2-4-8-18(16)35-27(23)31/h1-10,13,21,28-29H,11-12H2 |
| InChIKey | LUWBMVNGMBFIGY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 119.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|