C19H14O6 — CID 54679774
3-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl]-4-hydroxychromen-2-one (PubChem CID 54679774) has the molecular formula C19H14O6 and a molecular weight of 338.31 g/mol. Its IUPAC name is 3-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl]-4-hydroxychromen-2-one.
| Compound Name | 3-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl]-4-hydroxychromen-2-one |
|---|---|
| PubChem CID | 54679774 |
| Molecular Formula | C19H14O6 |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 3-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl]-4-hydroxychromen-2-one |
| SMILES | O=C(Cc1c(O)c2ccccc2oc1=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C19H14O6/c20-14(11-5-6-16-17(9-11)24-8-7-23-16)10-13-18(21)12-3-1-2-4-15(12)25-19(13)22/h1-6,9,21H,7-8,10H2 |
| InChIKey | RFYBRIMOFNHIRY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|