C26H28O9 — CID 101161930
3-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-triene-20-carbonyl)chromen-2-one (PubChem CID 101161930) has the molecular formula C26H28O9 and a molecular weight of 484.50 g/mol. Its IUPAC name is 3-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-triene-20-carbonyl)chromen-2-one.
| Compound Name | 3-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-triene-20-carbonyl)chromen-2-one |
|---|---|
| PubChem CID | 101161930 |
| Molecular Formula | C26H28O9 |
| Molecular Weight | 484.50 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 3-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-triene-20-carbonyl)chromen-2-one |
| SMILES | O=C(c1ccc2c(c1)OCCOCCOCCOCCOCCO2)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C26H28O9/c27-25(21-17-19-3-1-2-4-22(19)35-26(21)28)20-5-6-23-24(18-20)34-16-14-32-12-10-30-8-7-29-9-11-31-13-15-33-23/h1-6,17-18H,7-16H2 |
| InChIKey | ZHSIUPBKWWHJCZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 102.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|