C31H39NO10 — CID 134912074
7-(diethylamino)-3-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-triene-20-carbonyl)-5-methoxychromen-2-one (PubChem CID 134912074) has the molecular formula C31H39NO10 and a molecular weight of 585.65 g/mol. Its IUPAC name is 7-(diethylamino)-3-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-triene-20-carbonyl)-5-methoxychromen-2-one.
| Compound Name | 7-(diethylamino)-3-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-triene-20-carbonyl)-5-methoxychromen-2-one |
|---|---|
| PubChem CID | 134912074 |
| Molecular Formula | C31H39NO10 |
| Molecular Weight | 585.65 g/mol |
| Exact Mass | 585.26 |
| IUPAC Name | 7-(diethylamino)-3-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-triene-20-carbonyl)-5-methoxychromen-2-one |
| SMILES | CCN(CC)c1cc(OC)c2cc(C(=O)c3ccc4c(c3)OCCOCCOCCOCCOCCO4)c(=O)oc2c1 |
| InChI | InChI=1S/C31H39NO10/c1-4-32(5-2)23-19-27(35-3)24-21-25(31(34)42-28(24)20-23)30(33)22-6-7-26-29(18-22)41-17-15-39-13-11-37-9-8-36-10-12-38-14-16-40-26/h6-7,18-21H,4-5,8-17H2,1-3H3 |
| InChIKey | BPIXCHJCDMUFMK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 115.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.65 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|