C32H42O5 — CID 167410093
5,7-dimethoxy-3-(4-tetradecan-6-ylbenzoyl)chromen-2-one (PubChem CID 167410093) has the molecular formula C32H42O5 and a molecular weight of 506.68 g/mol. Its IUPAC name is 5,7-dimethoxy-3-(4-tetradecan-6-ylbenzoyl)chromen-2-one.
| Compound Name | 5,7-dimethoxy-3-(4-tetradecan-6-ylbenzoyl)chromen-2-one |
|---|---|
| PubChem CID | 167410093 |
| Molecular Formula | C32H42O5 |
| Molecular Weight | 506.68 g/mol |
| Exact Mass | 506.30 |
| IUPAC Name | 5,7-dimethoxy-3-(4-tetradecan-6-ylbenzoyl)chromen-2-one |
| SMILES | CCCCCCCCC(CCCCC)c1ccc(C(=O)c2cc3c(OC)cc(OC)cc3oc2=O)cc1 |
| InChI | InChI=1S/C32H42O5/c1-5-7-9-10-11-13-15-23(14-12-8-6-2)24-16-18-25(19-17-24)31(33)28-22-27-29(36-4)20-26(35-3)21-30(27)37-32(28)34/h16-23H,5-15H2,1-4H3 |
| InChIKey | DNCOSPSLUMRBRD-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.68 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|