C23H16O9 — CID 134251996
3-(5,7-dimethoxy-2-oxochromene-3-carbonyl)-5-methoxy-2-oxochromene-7-carbaldehyde (PubChem CID 134251996) has the molecular formula C23H16O9 and a molecular weight of 436.37 g/mol. Its IUPAC name is 3-(5,7-dimethoxy-2-oxochromene-3-carbonyl)-5-methoxy-2-oxochromene-7-carbaldehyde.
| Compound Name | 3-(5,7-dimethoxy-2-oxochromene-3-carbonyl)-5-methoxy-2-oxochromene-7-carbaldehyde |
|---|---|
| PubChem CID | 134251996 |
| Molecular Formula | C23H16O9 |
| Molecular Weight | 436.37 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | 3-(5,7-dimethoxy-2-oxochromene-3-carbonyl)-5-methoxy-2-oxochromene-7-carbaldehyde |
| SMILES | COc1cc(OC)c2cc(C(=O)c3cc4c(OC)cc(C=O)cc4oc3=O)c(=O)oc2c1 |
| InChI | InChI=1S/C23H16O9/c1-28-12-6-18(30-3)14-9-16(23(27)32-20(14)7-12)21(25)15-8-13-17(29-2)4-11(10-24)5-19(13)31-22(15)26/h4-10H,1-3H3 |
| InChIKey | ULVQYBJWWNPBFF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 122.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|