C22H20O8S — CID 73004920
5,7-dimethoxy-3-[4-(4-methoxyphenyl)-2-oxobut-3-enyl]sulfonylchromen-2-one (PubChem CID 73004920) has the molecular formula C22H20O8S and a molecular weight of 444.46 g/mol. Its IUPAC name is 5,7-dimethoxy-3-[4-(4-methoxyphenyl)-2-oxobut-3-enyl]sulfonylchromen-2-one.
| Compound Name | 5,7-dimethoxy-3-[4-(4-methoxyphenyl)-2-oxobut-3-enyl]sulfonylchromen-2-one |
|---|---|
| PubChem CID | 73004920 |
| Molecular Formula | C22H20O8S |
| Molecular Weight | 444.46 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | 5,7-dimethoxy-3-[4-(4-methoxyphenyl)-2-oxobut-3-enyl]sulfonylchromen-2-one |
| SMILES | COc1ccc(C=CC(=O)CS(=O)(=O)c2cc3c(OC)cc(OC)cc3oc2=O)cc1 |
| InChI | InChI=1S/C22H20O8S/c1-27-16-8-5-14(6-9-16)4-7-15(23)13-31(25,26)21-12-18-19(29-3)10-17(28-2)11-20(18)30-22(21)24/h4-12H,13H2,1-3H3 |
| InChIKey | SHGDQOIZAKZKFV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 109.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|