C19H20O6S — CID 66871241
1-(2,5-dimethoxy-4-methylsulfonylphenyl)-3-(4-methoxyphenyl)prop-2-en-1-one (PubChem CID 66871241) has the molecular formula C19H20O6S and a molecular weight of 376.43 g/mol. Its IUPAC name is 1-(2,5-dimethoxy-4-methylsulfonylphenyl)-3-(4-methoxyphenyl)prop-2-en-1-one.
| Compound Name | 1-(2,5-dimethoxy-4-methylsulfonylphenyl)-3-(4-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 66871241 |
| Molecular Formula | C19H20O6S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 1-(2,5-dimethoxy-4-methylsulfonylphenyl)-3-(4-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C=CC(=O)c2cc(OC)c(S(C)(=O)=O)cc2OC)cc1 |
| InChI | InChI=1S/C19H20O6S/c1-23-14-8-5-13(6-9-14)7-10-16(20)15-11-18(25-3)19(26(4,21)22)12-17(15)24-2/h5-12H,1-4H3 |
| InChIKey | UGZFDDDRSKSZSK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|