C17H16ClNO5S — CID 171919657
5-[(E)-3-(4-chlorophenyl)prop-2-enoyl]-2,4-dimethoxybenzenesulfonamide (PubChem CID 171919657) has the molecular formula C17H16ClNO5S and a molecular weight of 381.84 g/mol. Its IUPAC name is 5-[(E)-3-(4-chlorophenyl)prop-2-enoyl]-2,4-dimethoxybenzenesulfonamide.
| Compound Name | 5-[(E)-3-(4-chlorophenyl)prop-2-enoyl]-2,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 171919657 |
| Molecular Formula | C17H16ClNO5S |
| Molecular Weight | 381.84 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | 5-[(E)-3-(4-chlorophenyl)prop-2-enoyl]-2,4-dimethoxybenzenesulfonamide |
| SMILES | COc1cc(OC)c(S(N)(=O)=O)cc1C(=O)/C=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H16ClNO5S/c1-23-15-10-16(24-2)17(25(19,21)22)9-13(15)14(20)8-5-11-3-6-12(18)7-4-11/h3-10H,1-2H3,(H2,19,21,22)/b8-5+ |
| InChIKey | IRLYXMKSSDRMJB-VMPITWQZSA-N |
| XLogP | 2.90 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.84 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|