C16H13ClO4 — CID 67218270
3-(4-chlorophenyl)-1-(2,4-dihydroxy-6-methoxyphenyl)prop-2-en-1-one (PubChem CID 67218270) has the molecular formula C16H13ClO4 and a molecular weight of 304.73 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-(2,4-dihydroxy-6-methoxyphenyl)prop-2-en-1-one.
| Compound Name | 3-(4-chlorophenyl)-1-(2,4-dihydroxy-6-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 67218270 |
| Molecular Formula | C16H13ClO4 |
| Molecular Weight | 304.73 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 3-(4-chlorophenyl)-1-(2,4-dihydroxy-6-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(O)cc(O)c1C(=O)C=Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H13ClO4/c1-21-15-9-12(18)8-14(20)16(15)13(19)7-4-10-2-5-11(17)6-3-10/h2-9,18,20H,1H3 |
| InChIKey | ZXVVIVDMNYJIQC-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.73 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|