C29H23ClO4 — CID 163323163
3-(4-chlorophenyl)-1-[2-hydroxy-4,6-bis(phenylmethoxy)phenyl]prop-2-en-1-one (PubChem CID 163323163) has the molecular formula C29H23ClO4 and a molecular weight of 470.95 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-[2-hydroxy-4,6-bis(phenylmethoxy)phenyl]prop-2-en-1-one.
| Compound Name | 3-(4-chlorophenyl)-1-[2-hydroxy-4,6-bis(phenylmethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 163323163 |
| Molecular Formula | C29H23ClO4 |
| Molecular Weight | 470.95 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | 3-(4-chlorophenyl)-1-[2-hydroxy-4,6-bis(phenylmethoxy)phenyl]prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc(Cl)cc1)c1c(O)cc(OCc2ccccc2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C29H23ClO4/c30-24-14-11-21(12-15-24)13-16-26(31)29-27(32)17-25(33-19-22-7-3-1-4-8-22)18-28(29)34-20-23-9-5-2-6-10-23/h1-18,32H,19-20H2 |
| InChIKey | NEIYFBKZOWUBEO-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.95 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|