C27H36O5 — CID 89141541
(E)-3-(4-butoxyphenyl)-1-(2,4-dibutoxy-6-hydroxyphenyl)prop-2-en-1-one (PubChem CID 89141541) has the molecular formula C27H36O5 and a molecular weight of 440.58 g/mol. Its IUPAC name is (E)-3-(4-butoxyphenyl)-1-(2,4-dibutoxy-6-hydroxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(4-butoxyphenyl)-1-(2,4-dibutoxy-6-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 89141541 |
| Molecular Formula | C27H36O5 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | (E)-3-(4-butoxyphenyl)-1-(2,4-dibutoxy-6-hydroxyphenyl)prop-2-en-1-one |
| SMILES | CCCCOc1ccc(/C=C/C(=O)c2c(O)cc(OCCCC)cc2OCCCC)cc1 |
| InChI | InChI=1S/C27H36O5/c1-4-7-16-30-22-13-10-21(11-14-22)12-15-24(28)27-25(29)19-23(31-17-8-5-2)20-26(27)32-18-9-6-3/h10-15,19-20,29H,4-9,16-18H2,1-3H3/b15-12+ |
| InChIKey | JEULVMAZLKCAEG-NTCAYCPXSA-N |
| XLogP | 6.82 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|