C22H26O3 — CID 67541390
(E)-1-(4-hexoxy-2-hydroxyphenyl)-3-(4-methylphenyl)prop-2-en-1-one (PubChem CID 67541390) has the molecular formula C22H26O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is (E)-1-(4-hexoxy-2-hydroxyphenyl)-3-(4-methylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-hexoxy-2-hydroxyphenyl)-3-(4-methylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 67541390 |
| Molecular Formula | C22H26O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | (E)-1-(4-hexoxy-2-hydroxyphenyl)-3-(4-methylphenyl)prop-2-en-1-one |
| SMILES | CCCCCCOc1ccc(C(=O)/C=C/c2ccc(C)cc2)c(O)c1 |
| InChI | InChI=1S/C22H26O3/c1-3-4-5-6-15-25-19-12-13-20(22(24)16-19)21(23)14-11-18-9-7-17(2)8-10-18/h7-14,16,24H,3-6,15H2,1-2H3/b14-11+ |
| InChIKey | XTKIPUZYMGKETL-SDNWHVSQSA-N |
| XLogP | 5.56 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|