C20H22O3 — CID 139078667
(E)-1-[2-hydroxy-4-(2-methylpropoxy)phenyl]-3-(4-methylphenyl)prop-2-en-1-one (PubChem CID 139078667) has the molecular formula C20H22O3 and a molecular weight of 310.39 g/mol. Its IUPAC name is (E)-1-[2-hydroxy-4-(2-methylpropoxy)phenyl]-3-(4-methylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[2-hydroxy-4-(2-methylpropoxy)phenyl]-3-(4-methylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 139078667 |
| Molecular Formula | C20H22O3 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | (E)-1-[2-hydroxy-4-(2-methylpropoxy)phenyl]-3-(4-methylphenyl)prop-2-en-1-one |
| SMILES | Cc1ccc(/C=C/C(=O)c2ccc(OCC(C)C)cc2O)cc1 |
| InChI | InChI=1S/C20H22O3/c1-14(2)13-23-17-9-10-18(20(22)12-17)19(21)11-8-16-6-4-15(3)5-7-16/h4-12,14,22H,13H2,1-3H3/b11-8+ |
| InChIKey | CBUXEKDBCYHBMU-DHZHZOJOSA-N |
| XLogP | 4.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|