C24H28O3 — CID 19910204
(E)-3-(4-tert-butylphenyl)-1-[2-hydroxy-4-(3-methylbut-2-enoxy)phenyl]prop-2-en-1-one (PubChem CID 19910204) has the molecular formula C24H28O3 and a molecular weight of 364.49 g/mol. Its IUPAC name is (E)-3-(4-tert-butylphenyl)-1-[2-hydroxy-4-(3-methylbut-2-enoxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-tert-butylphenyl)-1-[2-hydroxy-4-(3-methylbut-2-enoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19910204 |
| Molecular Formula | C24H28O3 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | (E)-3-(4-tert-butylphenyl)-1-[2-hydroxy-4-(3-methylbut-2-enoxy)phenyl]prop-2-en-1-one |
| SMILES | CC(C)=CCOc1ccc(C(=O)/C=C/c2ccc(C(C)(C)C)cc2)c(O)c1 |
| InChI | InChI=1S/C24H28O3/c1-17(2)14-15-27-20-11-12-21(23(26)16-20)22(25)13-8-18-6-9-19(10-7-18)24(3,4)5/h6-14,16,26H,15H2,1-5H3/b13-8+ |
| InChIKey | XNGDMPANNUNEHL-MDWZMJQESA-N |
| XLogP | 5.93 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|