C20H20O5 — CID 57391893
(E)-3-(3,5-dimethoxyphenyl)-1-(2-hydroxy-4-prop-2-enoxyphenyl)prop-2-en-1-one (PubChem CID 57391893) has the molecular formula C20H20O5 and a molecular weight of 340.38 g/mol. Its IUPAC name is (E)-3-(3,5-dimethoxyphenyl)-1-(2-hydroxy-4-prop-2-enoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(3,5-dimethoxyphenyl)-1-(2-hydroxy-4-prop-2-enoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 57391893 |
| Molecular Formula | C20H20O5 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | (E)-3-(3,5-dimethoxyphenyl)-1-(2-hydroxy-4-prop-2-enoxyphenyl)prop-2-en-1-one |
| SMILES | C=CCOc1ccc(C(=O)/C=C/c2cc(OC)cc(OC)c2)c(O)c1 |
| InChI | InChI=1S/C20H20O5/c1-4-9-25-15-6-7-18(20(22)13-15)19(21)8-5-14-10-16(23-2)12-17(11-14)24-3/h4-8,10-13,22H,1,9H2,2-3H3/b8-5+ |
| InChIKey | RNFGCQKOWASNGZ-VMPITWQZSA-N |
| XLogP | 3.87 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|