C16H14O4 — CID 53405565
1-(2,4-dihydroxyphenyl)-3-(3-methoxyphenyl)prop-2-en-1-one (PubChem CID 53405565) has the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. Its IUPAC name is 1-(2,4-dihydroxyphenyl)-3-(3-methoxyphenyl)prop-2-en-1-one.
| Compound Name | 1-(2,4-dihydroxyphenyl)-3-(3-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 53405565 |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 1-(2,4-dihydroxyphenyl)-3-(3-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cccc(C=CC(=O)c2ccc(O)cc2O)c1 |
| InChI | InChI=1S/C16H14O4/c1-20-13-4-2-3-11(9-13)5-8-15(18)14-7-6-12(17)10-16(14)19/h2-10,17,19H,1H3 |
| InChIKey | AACDPQIFRBEZFP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|