C20H18O3 — CID 90682173
(1E,4E,6E)-7-(3-hydroxyphenyl)-1-(3-methoxyphenyl)hepta-1,4,6-trien-3-one (PubChem CID 90682173) has the molecular formula C20H18O3 and a molecular weight of 306.36 g/mol. Its IUPAC name is (1E,4E,6E)-7-(3-hydroxyphenyl)-1-(3-methoxyphenyl)hepta-1,4,6-trien-3-one.
| Compound Name | (1E,4E,6E)-7-(3-hydroxyphenyl)-1-(3-methoxyphenyl)hepta-1,4,6-trien-3-one |
|---|---|
| PubChem CID | 90682173 |
| Molecular Formula | C20H18O3 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | (1E,4E,6E)-7-(3-hydroxyphenyl)-1-(3-methoxyphenyl)hepta-1,4,6-trien-3-one |
| SMILES | COc1cccc(/C=C/C(=O)/C=C/C=C/c2cccc(O)c2)c1 |
| InChI | InChI=1S/C20H18O3/c1-23-20-11-5-8-17(15-20)12-13-18(21)9-3-2-6-16-7-4-10-19(22)14-16/h2-15,22H,1H3/b6-2+,9-3+,13-12+ |
| InChIKey | YPAQCPVMBAQCSM-DBEURBAASA-N |
| XLogP | 4.25 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|